C18H21N3O2S — CID 168910298
3-cyano-2-[(E)-dimethylaminomethylideneamino]-4-pent-4-ynyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid (PubChem CID 168910298) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 3-cyano-2-[(E)-dimethylaminomethylideneamino]-4-pent-4-ynyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid.
| Compound Name | 3-cyano-2-[(E)-dimethylaminomethylideneamino]-4-pent-4-ynyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid |
|---|---|
| PubChem CID | 168910298 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 3-cyano-2-[(E)-dimethylaminomethylideneamino]-4-pent-4-ynyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid |
| SMILES | C#CCCCC1(C(=O)O)CCCc2sc(/N=C/N(C)C)c(C#N)c21 |
| InChI | InChI=1S/C18H21N3O2S/c1-4-5-6-9-18(17(22)23)10-7-8-14-15(18)13(11-19)16(24-14)20-12-21(2)3/h1,12H,5-10H2,2-3H3,(H,22,23)/b20-12+ |
| InChIKey | AODLAKUFRIJNFN-UDWIEESQSA-N |
| XLogP | 3.30 |
| TPSA | 76.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|