C9H10ClN3S — CID 54464853
N'-(4-chloro-3-cyano-5-methylthiophen-2-yl)-N,N-dimethylmethanimidamide (PubChem CID 54464853) has the molecular formula C9H10ClN3S and a molecular weight of 227.72 g/mol. Its IUPAC name is N'-(4-chloro-3-cyano-5-methylthiophen-2-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(4-chloro-3-cyano-5-methylthiophen-2-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 54464853 |
| Molecular Formula | C9H10ClN3S |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | N'-(4-chloro-3-cyano-5-methylthiophen-2-yl)-N,N-dimethylmethanimidamide |
| SMILES | Cc1sc(N=CN(C)C)c(C#N)c1Cl |
| InChI | InChI=1S/C9H10ClN3S/c1-6-8(10)7(4-11)9(14-6)12-5-13(2)3/h5H,1-3H3 |
| InChIKey | XECSGPNRAOWUCC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|