C13H24NNaO2 — CID 168911697
sodium 3-(dec-1-enylamino)propanoate (PubChem CID 168911697) has the molecular formula C13H24NNaO2 and a molecular weight of 249.33 g/mol. Its IUPAC name is sodium 3-(dec-1-enylamino)propanoate.
| Compound Name | sodium 3-(dec-1-enylamino)propanoate |
|---|---|
| PubChem CID | 168911697 |
| Molecular Formula | C13H24NNaO2 |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | sodium 3-(dec-1-enylamino)propanoate |
| SMILES | CCCCCCCCC=CNCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H25NO2.Na/c1-2-3-4-5-6-7-8-9-11-14-12-10-13(15)16;/h9,11,14H,2-8,10,12H2,1H3,(H,15,16);/q;+1/p-1 |
| InChIKey | ZYAQENXYCZFMQV-UHFFFAOYSA-M |
| XLogP | -1.02 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|