C23H19N3O2S — CID 168913385
azane;2-[2-(3-ethynylphenyl)-1-(3-nitrophenyl)ethyl]-1,3-benzothiazole (PubChem CID 168913385) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is azane;2-[2-(3-ethynylphenyl)-1-(3-nitrophenyl)ethyl]-1,3-benzothiazole.
| Compound Name | azane;2-[2-(3-ethynylphenyl)-1-(3-nitrophenyl)ethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 168913385 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | azane;2-[2-(3-ethynylphenyl)-1-(3-nitrophenyl)ethyl]-1,3-benzothiazole |
| SMILES | C#Cc1cccc(CC(c2cccc([N+](=O)[O-])c2)c2nc3ccccc3s2)c1.N |
| InChI | InChI=1S/C23H16N2O2S.H3N/c1-2-16-7-5-8-17(13-16)14-20(18-9-6-10-19(15-18)25(26)27)23-24-21-11-3-4-12-22(21)28-23;/h1,3-13,15,20H,14H2;1H3 |
| InChIKey | MTBMPJKEMCUTFR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|