C23H32FN3O2 — CID 168915293
N-[2-(dimethylamino)ethyl]-4-methoxybenzamide;4-(4-fluorophenyl)piperidine (PubChem CID 168915293) has the molecular formula C23H32FN3O2 and a molecular weight of 401.53 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-methoxybenzamide;4-(4-fluorophenyl)piperidine.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-methoxybenzamide;4-(4-fluorophenyl)piperidine |
|---|---|
| PubChem CID | 168915293 |
| Molecular Formula | C23H32FN3O2 |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-methoxybenzamide;4-(4-fluorophenyl)piperidine |
| SMILES | COc1ccc(C(=O)NCCN(C)C)cc1.Fc1ccc(C2CCNCC2)cc1 |
| InChI | InChI=1S/C12H18N2O2.C11H14FN/c1-14(2)9-8-13-12(15)10-4-6-11(16-3)7-5-10;12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h4-7H,8-9H2,1-3H3,(H,13,15);1-4,10,13H,5-8H2 |
| InChIKey | XTIBANGWSCPXOJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |