C20H25ClN2O3 — CID 154892672
N-[(2,6-dimethoxyphenyl)methyl]-4-pyrrolidin-3-ylbenzamide;hydrochloride (PubChem CID 154892672) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is N-[(2,6-dimethoxyphenyl)methyl]-4-pyrrolidin-3-ylbenzamide;hydrochloride.
| Compound Name | N-[(2,6-dimethoxyphenyl)methyl]-4-pyrrolidin-3-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 154892672 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[(2,6-dimethoxyphenyl)methyl]-4-pyrrolidin-3-ylbenzamide;hydrochloride |
| SMILES | COc1cccc(OC)c1CNC(=O)c1ccc(C2CCNC2)cc1.Cl |
| InChI | InChI=1S/C20H24N2O3.ClH/c1-24-18-4-3-5-19(25-2)17(18)13-22-20(23)15-8-6-14(7-9-15)16-10-11-21-12-16;/h3-9,16,21H,10-13H2,1-2H3,(H,22,23);1H |
| InChIKey | KCEDNRMBLYWJMJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |