C20H40N2O4 — CID 168915500
ethanol;methylcyclohexane;3-methyl-N-(2-oxopropyl)-2-(propanoylamino)butanamide (PubChem CID 168915500) has the molecular formula C20H40N2O4 and a molecular weight of 372.55 g/mol. Its IUPAC name is ethanol;methylcyclohexane;3-methyl-N-(2-oxopropyl)-2-(propanoylamino)butanamide.
| Compound Name | ethanol;methylcyclohexane;3-methyl-N-(2-oxopropyl)-2-(propanoylamino)butanamide |
|---|---|
| PubChem CID | 168915500 |
| Molecular Formula | C20H40N2O4 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | ethanol;methylcyclohexane;3-methyl-N-(2-oxopropyl)-2-(propanoylamino)butanamide |
| SMILES | CC1CCCCC1.CCC(=O)NC(C(=O)NCC(C)=O)C(C)C.CCO |
| InChI | InChI=1S/C11H20N2O3.C7H14.C2H6O/c1-5-9(15)13-10(7(2)3)11(16)12-6-8(4)14;1-7-5-3-2-4-6-7;1-2-3/h7,10H,5-6H2,1-4H3,(H,12,16)(H,13,15);7H,2-6H2,1H3;3H,2H2,1H3 |
| InChIKey | IENGKTUVYPEOLZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |