C38H55B2F3N2O5S — CID 168917690
CID 168917690 (PubChem CID 168917690) has the molecular formula C38H55B2F3N2O5S and a molecular weight of 730.55 g/mol.
| Compound Name | CID 168917690 |
|---|---|
| PubChem CID | 168917690 |
| Molecular Formula | C38H55B2F3N2O5S |
| Molecular Weight | 730.55 g/mol |
| Exact Mass | 730.40 |
| IUPAC Name | — |
| SMILES | CCCC1Cc2cc(OC(=O)N3CCC(N(C)C)CC3)c(OC)cc2C2CCC3(C)C(=O)CCC3C12.[B]C(F)(F)C([B])(F)CCCS(=O)C(=C)C |
| InChI | InChI=1S/C30H44N2O4.C8H11B2F3OS/c1-6-7-19-16-20-17-26(36-29(34)32-14-11-21(12-15-32)31(3)4)25(35-5)18-23(20)22-10-13-30(2)24(28(19)22)8-9-27(30)33;1-6(2)15(14)5-3-4-7(9,11)8(10,12)13/h17-19,21-22,24,28H,6-16H2,1-5H3;1,3-5H2,2H3 |
| InChIKey | DDHYGIPEWLJMMV-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.55 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|