C31H47NO3 — CID 168918012
7-(3,3-dimethylpentyl)-2-methoxy-13-methyl-3-(2-methylmorpholin-4-yl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 168918012) has the molecular formula C31H47NO3 and a molecular weight of 481.72 g/mol. Its IUPAC name is 7-(3,3-dimethylpentyl)-2-methoxy-13-methyl-3-(2-methylmorpholin-4-yl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | 7-(3,3-dimethylpentyl)-2-methoxy-13-methyl-3-(2-methylmorpholin-4-yl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 168918012 |
| Molecular Formula | C31H47NO3 |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 481.36 |
| IUPAC Name | 7-(3,3-dimethylpentyl)-2-methoxy-13-methyl-3-(2-methylmorpholin-4-yl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CCC(C)(C)CCC1Cc2cc(N3CCOC(C)C3)c(OC)cc2C2CCC3(C)C(=O)CCC3C12 |
| InChI | InChI=1S/C31H47NO3/c1-7-30(3,4)12-10-21-16-22-17-26(32-14-15-35-20(2)19-32)27(34-6)18-24(22)23-11-13-31(5)25(29(21)23)8-9-28(31)33/h17-18,20-21,23,25,29H,7-16,19H2,1-6H3 |
| InChIKey | NDQXBKDCCYXVDH-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |