C27H32N2O4 — CID 168918435
5-(4-tert-butylphenoxy)-2-carbamoylbenzoic acid;3-propan-2-ylaniline (PubChem CID 168918435) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is 5-(4-tert-butylphenoxy)-2-carbamoylbenzoic acid;3-propan-2-ylaniline.
| Compound Name | 5-(4-tert-butylphenoxy)-2-carbamoylbenzoic acid;3-propan-2-ylaniline |
|---|---|
| PubChem CID | 168918435 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 5-(4-tert-butylphenoxy)-2-carbamoylbenzoic acid;3-propan-2-ylaniline |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(C(N)=O)c(C(=O)O)c2)cc1.CC(C)c1cccc(N)c1 |
| InChI | InChI=1S/C18H19NO4.C9H13N/c1-18(2,3)11-4-6-12(7-5-11)23-13-8-9-14(16(19)20)15(10-13)17(21)22;1-7(2)8-4-3-5-9(10)6-8/h4-10H,1-3H3,(H2,19,20)(H,21,22);3-7H,10H2,1-2H3 |
| InChIKey | BAWQDZLVDPRWSC-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|