C27H32N4O2 — CID 16891935
N-[3-[4-(azepan-1-yl)phenyl]propyl]-N'-(2-methylquinolin-4-yl)oxamide (PubChem CID 16891935) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-[3-[4-(azepan-1-yl)phenyl]propyl]-N'-(2-methylquinolin-4-yl)oxamide.
| Compound Name | N-[3-[4-(azepan-1-yl)phenyl]propyl]-N'-(2-methylquinolin-4-yl)oxamide |
|---|---|
| PubChem CID | 16891935 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | N-[3-[4-(azepan-1-yl)phenyl]propyl]-N'-(2-methylquinolin-4-yl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)NCCCc2ccc(N3CCCCCC3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C27H32N4O2/c1-20-19-25(23-10-4-5-11-24(23)29-20)30-27(33)26(32)28-16-8-9-21-12-14-22(15-13-21)31-17-6-2-3-7-18-31/h4-5,10-15,19H,2-3,6-9,16-18H2,1H3,(H,28,32)(H,29,30,33) |
| InChIKey | CCBAPHKSTXPKMW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|