About CID 168919655
CID 168919655 (PubChem CID 168919655) has the molecular formula C7H14O2S2
and a molecular weight of 194.32 g/mol.
Molecular Properties
| Compound Name | CID 168919655 |
| PubChem CID | 168919655 |
| Molecular Formula | C7H14O2S2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | — |
| SMILES | CC(=O)C1CCCCO1.SS |
| InChI | InChI=1S/C7H12O2.H2S2/c1-6(8)7-4-2-3-5-9-7;1-2/h7H,2-5H2,1H3;1-2H |
| InChIKey | APBJDRZJCMFLSF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 168919655 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 168919655?
The IUPAC name of CID 168919655 (CID 168919655) is not available.
What is the SMILES notation for CID 168919655?
The canonical SMILES for CID 168919655 is CC(=O)C1CCCCO1.SS.
What is the InChIKey of CID 168919655?
The InChIKey is APBJDRZJCMFLSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.H2S2/c1-6(8)7-4-2-3-5-9-7;1-2/h7H,2-5H2,1H3;1-2H.
What are the key properties of CID 168919655?
CID 168919655 has a molecular weight of 194.32 g/mol, XLogP of 1.91, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 168919655 is sourced from PubChem (CID 168919655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).