C9H14F3N — CID 168920648
ethane;N-[(2Z)-1,1,1-trifluoro-3-methylpenta-2,4-dien-2-yl]methanimine (PubChem CID 168920648) has the molecular formula C9H14F3N and a molecular weight of 193.21 g/mol. Its IUPAC name is ethane;N-[(2Z)-1,1,1-trifluoro-3-methylpenta-2,4-dien-2-yl]methanimine.
| Compound Name | ethane;N-[(2Z)-1,1,1-trifluoro-3-methylpenta-2,4-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 168920648 |
| Molecular Formula | C9H14F3N |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | ethane;N-[(2Z)-1,1,1-trifluoro-3-methylpenta-2,4-dien-2-yl]methanimine |
| SMILES | C=C/C(C)=C(\N=C)C(F)(F)F.CC |
| InChI | InChI=1S/C7H8F3N.C2H6/c1-4-5(2)6(11-3)7(8,9)10;1-2/h4H,1,3H2,2H3;1-2H3/b6-5-; |
| InChIKey | NYFRQQBPHRXCML-YSMBQZINSA-N |
| XLogP | 3.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|