C11H19N3O — CID 168920810
3-[C-[(Z)-but-1-enyl]-N-methylcarbonimidoyl]-4-methylpiperazin-2-one (PubChem CID 168920810) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-[C-[(Z)-but-1-enyl]-N-methylcarbonimidoyl]-4-methylpiperazin-2-one.
| Compound Name | 3-[C-[(Z)-but-1-enyl]-N-methylcarbonimidoyl]-4-methylpiperazin-2-one |
|---|---|
| PubChem CID | 168920810 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 3-[C-[(Z)-but-1-enyl]-N-methylcarbonimidoyl]-4-methylpiperazin-2-one |
| SMILES | CC/C=C\C(=N/C)C1C(=O)NCCN1C |
| InChI | InChI=1S/C11H19N3O/c1-4-5-6-9(12-2)10-11(15)13-7-8-14(10)3/h5-6,10H,4,7-8H2,1-3H3,(H,13,15)/b6-5-,12-9+ |
| InChIKey | KMPDAZHCQKETLC-ZCRLHDOISA-N |
| XLogP | 0.45 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|