C12H13IN4O — CID 168922548
4-(2-iodopyrido[3,2-d]pyrimidin-4-yl)-3-methylmorpholine (PubChem CID 168922548) has the molecular formula C12H13IN4O and a molecular weight of 356.17 g/mol. Its IUPAC name is 4-(2-iodopyrido[3,2-d]pyrimidin-4-yl)-3-methylmorpholine.
| Compound Name | 4-(2-iodopyrido[3,2-d]pyrimidin-4-yl)-3-methylmorpholine |
|---|---|
| PubChem CID | 168922548 |
| Molecular Formula | C12H13IN4O |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 4-(2-iodopyrido[3,2-d]pyrimidin-4-yl)-3-methylmorpholine |
| SMILES | CC1COCCN1c1nc(I)nc2cccnc12 |
| InChI | InChI=1S/C12H13IN4O/c1-8-7-18-6-5-17(8)11-10-9(3-2-4-14-10)15-12(13)16-11/h2-4,8H,5-7H2,1H3 |
| InChIKey | IYBJDUUOJWHONW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|