C9H10N4O — CID 168922997
2-(1,5-dimethylpyrazol-3-yl)-1H-pyrimidin-6-one (PubChem CID 168922997) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is 2-(1,5-dimethylpyrazol-3-yl)-1H-pyrimidin-6-one.
| Compound Name | 2-(1,5-dimethylpyrazol-3-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 168922997 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 2-(1,5-dimethylpyrazol-3-yl)-1H-pyrimidin-6-one |
| SMILES | Cc1cc(-c2nccc(=O)[nH]2)nn1C |
| InChI | InChI=1S/C9H10N4O/c1-6-5-7(12-13(6)2)9-10-4-3-8(14)11-9/h3-5H,1-2H3,(H,10,11,14) |
| InChIKey | UXBLWTZURGYLRD-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |