C12H14F3N5O — CID 138053481
1-methyl-3-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethylamino]pyrazin-2-one (PubChem CID 138053481) has the molecular formula C12H14F3N5O and a molecular weight of 301.27 g/mol. Its IUPAC name is 1-methyl-3-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethylamino]pyrazin-2-one.
| Compound Name | 1-methyl-3-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethylamino]pyrazin-2-one |
|---|---|
| PubChem CID | 138053481 |
| Molecular Formula | C12H14F3N5O |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-methyl-3-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethylamino]pyrazin-2-one |
| SMILES | Cc1cc(C(F)(F)F)nn1CCNc1nccn(C)c1=O |
| InChI | InChI=1S/C12H14F3N5O/c1-8-7-9(12(13,14)15)18-20(8)6-4-17-10-11(21)19(2)5-3-16-10/h3,5,7H,4,6H2,1-2H3,(H,16,17) |
| InChIKey | MDPBFTVUNFJFSD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |