C13H15F3N4O — CID 91774793
1-methyl-N-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]pyrrole-2-carboxamide (PubChem CID 91774793) has the molecular formula C13H15F3N4O and a molecular weight of 300.28 g/mol. Its IUPAC name is 1-methyl-N-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]pyrrole-2-carboxamide.
| Compound Name | 1-methyl-N-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 91774793 |
| Molecular Formula | C13H15F3N4O |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-methyl-N-[2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]pyrrole-2-carboxamide |
| SMILES | Cc1cc(C(F)(F)F)nn1CCNC(=O)c1cccn1C |
| InChI | InChI=1S/C13H15F3N4O/c1-9-8-11(13(14,15)16)18-20(9)7-5-17-12(21)10-4-3-6-19(10)2/h3-4,6,8H,5,7H2,1-2H3,(H,17,21) |
| InChIKey | UVPRCHLBGKZPGA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |