C18H16ClN3O3S2 — CID 168925382
N-[5-(3-chloroisoquinolin-6-yl)-1,3-thiazol-2-yl]-1,1-dioxothiane-4-carboxamide (PubChem CID 168925382) has the molecular formula C18H16ClN3O3S2 and a molecular weight of 421.93 g/mol. Its IUPAC name is N-[5-(3-chloroisoquinolin-6-yl)-1,3-thiazol-2-yl]-1,1-dioxothiane-4-carboxamide.
| Compound Name | N-[5-(3-chloroisoquinolin-6-yl)-1,3-thiazol-2-yl]-1,1-dioxothiane-4-carboxamide |
|---|---|
| PubChem CID | 168925382 |
| Molecular Formula | C18H16ClN3O3S2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | N-[5-(3-chloroisoquinolin-6-yl)-1,3-thiazol-2-yl]-1,1-dioxothiane-4-carboxamide |
| SMILES | O=C(Nc1ncc(-c2ccc3cnc(Cl)cc3c2)s1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C18H16ClN3O3S2/c19-16-8-14-7-12(1-2-13(14)9-20-16)15-10-21-18(26-15)22-17(23)11-3-5-27(24,25)6-4-11/h1-2,7-11H,3-6H2,(H,21,22,23) |
| InChIKey | YMEQJLLGKXKYAJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|