C10H22N2O — CID 168925529
2,5-dimethyl-1H-pyrimidin-6-one;ethane;molecular hydrogen (PubChem CID 168925529) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 2,5-dimethyl-1H-pyrimidin-6-one;ethane;molecular hydrogen.
| Compound Name | 2,5-dimethyl-1H-pyrimidin-6-one;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 168925529 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 2,5-dimethyl-1H-pyrimidin-6-one;ethane;molecular hydrogen |
| SMILES | CC.CC.Cc1ncc(C)c(=O)[nH]1.[H][H] |
| InChI | InChI=1S/C6H8N2O.2C2H6.H2/c1-4-3-7-5(2)8-6(4)9;2*1-2;/h3H,1-2H3,(H,7,8,9);2*1-2H3;1H |
| InChIKey | SPLGROUAKXFSIZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |