C15H15F3N4O — CID 168926229
1-(1-methylpiperidin-4-yl)-2-oxo-6-(trifluoromethyl)-3H-benzimidazole-5-carbonitrile (PubChem CID 168926229) has the molecular formula C15H15F3N4O and a molecular weight of 324.31 g/mol. Its IUPAC name is 1-(1-methylpiperidin-4-yl)-2-oxo-6-(trifluoromethyl)-3H-benzimidazole-5-carbonitrile.
| Compound Name | 1-(1-methylpiperidin-4-yl)-2-oxo-6-(trifluoromethyl)-3H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 168926229 |
| Molecular Formula | C15H15F3N4O |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-(1-methylpiperidin-4-yl)-2-oxo-6-(trifluoromethyl)-3H-benzimidazole-5-carbonitrile |
| SMILES | CN1CCC(n2c(=O)[nH]c3cc(C#N)c(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C15H15F3N4O/c1-21-4-2-10(3-5-21)22-13-7-11(15(16,17)18)9(8-19)6-12(13)20-14(22)23/h6-7,10H,2-5H2,1H3,(H,20,23) |
| InChIKey | SZXSPLRUNANNBX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |