About ethane;2-(4-methyl-2-pyridinyl)-1,3,4-oxadiazole
ethane;2-(4-methyl-2-pyridinyl)-1,3,4-oxadiazole (PubChem CID 168929695) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is ethane;2-(4-methyl-2-pyridinyl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | ethane;2-(4-methyl-2-pyridinyl)-1,3,4-oxadiazole |
| PubChem CID | 168929695 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | ethane;2-(4-methyl-2-pyridinyl)-1,3,4-oxadiazole |
| SMILES | CC.Cc1ccnc(-c2nnco2)c1 |
| InChI | InChI=1S/C8H7N3O.C2H6/c1-6-2-3-9-7(4-6)8-11-10-5-12-8;1-2/h2-5H,1H3;1-2H3 |
| InChIKey | JNDFUIDEJGCCOC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;2-(4-methyl-2-pyridinyl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(4-methyl-2-pyridinyl)-1,3,4-oxadiazole?
The IUPAC name of ethane;2-(4-methyl-2-pyridinyl)-1,3,4-oxadiazole (CID 168929695) is ethane;2-(4-methyl-2-pyridinyl)-1,3,4-oxadiazole.
What is the SMILES notation for ethane;2-(4-methyl-2-pyridinyl)-1,3,4-oxadiazole?
The canonical SMILES for ethane;2-(4-methyl-2-pyridinyl)-1,3,4-oxadiazole is CC.Cc1ccnc(-c2nnco2)c1.
What is the InChIKey of ethane;2-(4-methyl-2-pyridinyl)-1,3,4-oxadiazole?
The InChIKey is JNDFUIDEJGCCOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O.C2H6/c1-6-2-3-9-7(4-6)8-11-10-5-12-8;1-2/h2-5H,1H3;1-2H3.
What are the key properties of ethane;2-(4-methyl-2-pyridinyl)-1,3,4-oxadiazole?
ethane;2-(4-methyl-2-pyridinyl)-1,3,4-oxadiazole has a molecular weight of 191.23 g/mol, XLogP of 2.47, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(4-methyl-2-pyridinyl)-1,3,4-oxadiazole is sourced from PubChem (CID 168929695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).