C26H28N4O2 — CID 168930521
4-[(1E,3Z)-1,4-diamino-4-[5-[2-(2-methoxypropan-2-yl)-4-pyridinyl]-2-methylphenyl]buta-1,3-dien-2-yl]pyridine-2-carbaldehyde (PubChem CID 168930521) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 4-[(1E,3Z)-1,4-diamino-4-[5-[2-(2-methoxypropan-2-yl)-4-pyridinyl]-2-methylphenyl]buta-1,3-dien-2-yl]pyridine-2-carbaldehyde.
| Compound Name | 4-[(1E,3Z)-1,4-diamino-4-[5-[2-(2-methoxypropan-2-yl)-4-pyridinyl]-2-methylphenyl]buta-1,3-dien-2-yl]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 168930521 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 4-[(1E,3Z)-1,4-diamino-4-[5-[2-(2-methoxypropan-2-yl)-4-pyridinyl]-2-methylphenyl]buta-1,3-dien-2-yl]pyridine-2-carbaldehyde |
| SMILES | COC(C)(C)c1cc(-c2ccc(C)c(/C(N)=C/C(=C\N)c3ccnc(C=O)c3)c2)ccn1 |
| InChI | InChI=1S/C26H28N4O2/c1-17-5-6-18(20-8-10-30-25(14-20)26(2,3)32-4)12-23(17)24(28)13-21(15-27)19-7-9-29-22(11-19)16-31/h5-16H,27-28H2,1-4H3/b21-15+,24-13- |
| InChIKey | MVVVEOQVQARHIF-UJOPEJSGSA-N |
| XLogP | 4.45 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|