C22H23Cl3FN5O3 — CID 168928432
4-[6-[4-fluoro-2-methyl-5-(2,2,2-trichloroethoxy)phenyl]pyridazin-4-yl]pyridine-2-carbaldehyde;formamide;N-methylmethanamine (PubChem CID 168928432) has the molecular formula C22H23Cl3FN5O3 and a molecular weight of 530.82 g/mol. Its IUPAC name is 4-[6-[4-fluoro-2-methyl-5-(2,2,2-trichloroethoxy)phenyl]pyridazin-4-yl]pyridine-2-carbaldehyde;formamide;N-methylmethanamine.
| Compound Name | 4-[6-[4-fluoro-2-methyl-5-(2,2,2-trichloroethoxy)phenyl]pyridazin-4-yl]pyridine-2-carbaldehyde;formamide;N-methylmethanamine |
|---|---|
| PubChem CID | 168928432 |
| Molecular Formula | C22H23Cl3FN5O3 |
| Molecular Weight | 530.82 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | 4-[6-[4-fluoro-2-methyl-5-(2,2,2-trichloroethoxy)phenyl]pyridazin-4-yl]pyridine-2-carbaldehyde;formamide;N-methylmethanamine |
| SMILES | CNC.Cc1cc(F)c(OCC(Cl)(Cl)Cl)cc1-c1cc(-c2ccnc(C=O)c2)cnn1.NC=O |
| InChI | InChI=1S/C19H13Cl3FN3O2.C2H7N.CH3NO/c1-11-4-16(23)18(28-10-19(20,21)22)7-15(11)17-6-13(8-25-26-17)12-2-3-24-14(5-12)9-27;1-3-2;2-1-3/h2-9H,10H2,1H3;3H,1-2H3;1H,(H2,2,3) |
| InChIKey | MCLOJKGCIATJBO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.82 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|