About ethane;4-(2-fluoro-3-methylphenyl)pyridine-2-carbaldehyde;N-methylmethanamine
ethane;4-(2-fluoro-3-methylphenyl)pyridine-2-carbaldehyde;N-methylmethanamine (PubChem CID 178155038) has the molecular formula C17H23FN2O
and a molecular weight of 290.38 g/mol. Its IUPAC name is ethane;4-(2-fluoro-3-methylphenyl)pyridine-2-carbaldehyde;N-methylmethanamine.
Molecular Properties
| Compound Name | ethane;4-(2-fluoro-3-methylphenyl)pyridine-2-carbaldehyde;N-methylmethanamine |
| PubChem CID | 178155038 |
| Molecular Formula | C17H23FN2O |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | ethane;4-(2-fluoro-3-methylphenyl)pyridine-2-carbaldehyde;N-methylmethanamine |
| SMILES | CC.CNC.Cc1cccc(-c2ccnc(C=O)c2)c1F |
| InChI | InChI=1S/C13H10FNO.C2H7N.C2H6/c1-9-3-2-4-12(13(9)14)10-5-6-15-11(7-10)8-16;1-3-2;1-2/h2-8H,1H3;3H,1-2H3;1-2H3 |
| InChIKey | PPSAKOCQWORGKA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-(2-fluoro-3-methylphenyl)pyridine-2-carbaldehyde;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(2-fluoro-3-methylphenyl)pyridine-2-carbaldehyde;N-methylmethanamine?
The IUPAC name of ethane;4-(2-fluoro-3-methylphenyl)pyridine-2-carbaldehyde;N-methylmethanamine (CID 178155038) is ethane;4-(2-fluoro-3-methylphenyl)pyridine-2-carbaldehyde;N-methylmethanamine.
What is the SMILES notation for ethane;4-(2-fluoro-3-methylphenyl)pyridine-2-carbaldehyde;N-methylmethanamine?
The canonical SMILES for ethane;4-(2-fluoro-3-methylphenyl)pyridine-2-carbaldehyde;N-methylmethanamine is CC.CNC.Cc1cccc(-c2ccnc(C=O)c2)c1F.
What is the InChIKey of ethane;4-(2-fluoro-3-methylphenyl)pyridine-2-carbaldehyde;N-methylmethanamine?
The InChIKey is PPSAKOCQWORGKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10FNO.C2H7N.C2H6/c1-9-3-2-4-12(13(9)14)10-5-6-15-11(7-10)8-16;1-3-2;1-2/h2-8H,1H3;3H,1-2H3;1-2H3.
What are the key properties of ethane;4-(2-fluoro-3-methylphenyl)pyridine-2-carbaldehyde;N-methylmethanamine?
ethane;4-(2-fluoro-3-methylphenyl)pyridine-2-carbaldehyde;N-methylmethanamine has a molecular weight of 290.38 g/mol, XLogP of 3.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(2-fluoro-3-methylphenyl)pyridine-2-carbaldehyde;N-methylmethanamine is sourced from PubChem (CID 178155038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).