C12H8Cl2FN — CID 125484786
2,6-dichloro-4-(2-fluoro-3-methylphenyl)pyridine (PubChem CID 125484786) has the molecular formula C12H8Cl2FN and a molecular weight of 256.11 g/mol. Its IUPAC name is 2,6-dichloro-4-(2-fluoro-3-methylphenyl)pyridine.
| Compound Name | 2,6-dichloro-4-(2-fluoro-3-methylphenyl)pyridine |
|---|---|
| PubChem CID | 125484786 |
| Molecular Formula | C12H8Cl2FN |
| Molecular Weight | 256.11 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | 2,6-dichloro-4-(2-fluoro-3-methylphenyl)pyridine |
| SMILES | Cc1cccc(-c2cc(Cl)nc(Cl)c2)c1F |
| InChI | InChI=1S/C12H8Cl2FN/c1-7-3-2-4-9(12(7)15)8-5-10(13)16-11(14)6-8/h2-6H,1H3 |
| InChIKey | WELAMGNCBOVNBN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.11 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|