C14H12BrClN2O3S — CID 168931538
3-bromo-8-chloro-6-(oxan-2-yl)thieno[2,3-e]indazole 1,1-dioxide (PubChem CID 168931538) has the molecular formula C14H12BrClN2O3S and a molecular weight of 403.69 g/mol. Its IUPAC name is 3-bromo-8-chloro-6-(oxan-2-yl)thieno[2,3-e]indazole 1,1-dioxide.
| Compound Name | 3-bromo-8-chloro-6-(oxan-2-yl)thieno[2,3-e]indazole 1,1-dioxide |
|---|---|
| PubChem CID | 168931538 |
| Molecular Formula | C14H12BrClN2O3S |
| Molecular Weight | 403.69 g/mol |
| Exact Mass | 401.94 |
| IUPAC Name | 3-bromo-8-chloro-6-(oxan-2-yl)thieno[2,3-e]indazole 1,1-dioxide |
| SMILES | O=S1(=O)C=C(Br)c2ccc3c(c(Cl)nn3C3CCCCO3)c21 |
| InChI | InChI=1S/C14H12BrClN2O3S/c15-9-7-22(19,20)13-8(9)4-5-10-12(13)14(16)17-18(10)11-3-1-2-6-21-11/h4-5,7,11H,1-3,6H2 |
| InChIKey | SIDZOVWSFJCTDD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.69 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |