C13H11FO5S — CID 168931957
4-(4-fluoro-5-hydroxy-6-methoxy-1-benzothiophen-2-yl)-4-oxobutanoic acid (PubChem CID 168931957) has the molecular formula C13H11FO5S and a molecular weight of 298.29 g/mol. Its IUPAC name is 4-(4-fluoro-5-hydroxy-6-methoxy-1-benzothiophen-2-yl)-4-oxobutanoic acid.
| Compound Name | 4-(4-fluoro-5-hydroxy-6-methoxy-1-benzothiophen-2-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 168931957 |
| Molecular Formula | C13H11FO5S |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 4-(4-fluoro-5-hydroxy-6-methoxy-1-benzothiophen-2-yl)-4-oxobutanoic acid |
| SMILES | COc1cc2sc(C(=O)CCC(=O)O)cc2c(F)c1O |
| InChI | InChI=1S/C13H11FO5S/c1-19-8-5-9-6(12(14)13(8)18)4-10(20-9)7(15)2-3-11(16)17/h4-5,18H,2-3H2,1H3,(H,16,17) |
| InChIKey | OXFRIYCMZOZTFO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |