C27H25F2O11PS2 — CID 170447629
4-[4-fluoro-5-[3-[[4-fluoro-6-methoxy-2-(2-phosphonoacetyl)-1-benzothiophen-5-yl]oxy]propoxy]-6-methoxy-1-benzothiophen-2-yl]-4-oxobutanoic acid (PubChem CID 170447629) has the molecular formula C27H25F2O11PS2 and a molecular weight of 658.59 g/mol. Its IUPAC name is 4-[4-fluoro-5-[3-[[4-fluoro-6-methoxy-2-(2-phosphonoacetyl)-1-benzothiophen-5-yl]oxy]propoxy]-6-methoxy-1-benzothiophen-2-yl]-4-oxobutanoic acid.
| Compound Name | 4-[4-fluoro-5-[3-[[4-fluoro-6-methoxy-2-(2-phosphonoacetyl)-1-benzothiophen-5-yl]oxy]propoxy]-6-methoxy-1-benzothiophen-2-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 170447629 |
| Molecular Formula | C27H25F2O11PS2 |
| Molecular Weight | 658.59 g/mol |
| Exact Mass | 658.05 |
| IUPAC Name | 4-[4-fluoro-5-[3-[[4-fluoro-6-methoxy-2-(2-phosphonoacetyl)-1-benzothiophen-5-yl]oxy]propoxy]-6-methoxy-1-benzothiophen-2-yl]-4-oxobutanoic acid |
| SMILES | COc1cc2sc(C(=O)CCC(=O)O)cc2c(F)c1OCCCOc1c(OC)cc2sc(C(=O)CP(=O)(O)O)cc2c1F |
| InChI | InChI=1S/C27H25F2O11PS2/c1-37-17-10-19-13(8-21(42-19)15(30)4-5-23(32)33)24(28)26(17)39-6-3-7-40-27-18(38-2)11-20-14(25(27)29)9-22(43-20)16(31)12-41(34,35)36/h8-11H,3-7,12H2,1-2H3,(H,32,33)(H2,34,35,36) |
| InChIKey | UFQJCRDPAREIRV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|