C16H10Cl2N2O2 — CID 168932078
methyl 2-(1,7-dichloro-2,6-naphthyridin-3-yl)benzoate (PubChem CID 168932078) has the molecular formula C16H10Cl2N2O2 and a molecular weight of 333.17 g/mol. Its IUPAC name is methyl 2-(1,7-dichloro-2,6-naphthyridin-3-yl)benzoate.
| Compound Name | methyl 2-(1,7-dichloro-2,6-naphthyridin-3-yl)benzoate |
|---|---|
| PubChem CID | 168932078 |
| Molecular Formula | C16H10Cl2N2O2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | methyl 2-(1,7-dichloro-2,6-naphthyridin-3-yl)benzoate |
| SMILES | COC(=O)c1ccccc1-c1cc2cnc(Cl)cc2c(Cl)n1 |
| InChI | InChI=1S/C16H10Cl2N2O2/c1-22-16(21)11-5-3-2-4-10(11)13-6-9-8-19-14(17)7-12(9)15(18)20-13/h2-8H,1H3 |
| InChIKey | VGNIMCQEWQNNQK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|