C12H15N — CID 168932582
(3E,4Z)-4-butan-2-ylidene-3-prop-2-enylidenepyridine (PubChem CID 168932582) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (3E,4Z)-4-butan-2-ylidene-3-prop-2-enylidenepyridine.
| Compound Name | (3E,4Z)-4-butan-2-ylidene-3-prop-2-enylidenepyridine |
|---|---|
| PubChem CID | 168932582 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (3E,4Z)-4-butan-2-ylidene-3-prop-2-enylidenepyridine |
| SMILES | C=C/C=c1/cncc/c1=C(\C)CC |
| InChI | InChI=1S/C12H15N/c1-4-6-11-9-13-8-7-12(11)10(3)5-2/h4,6-9H,1,5H2,2-3H3/b11-6-,12-10- |
| InChIKey | RJEYCZAVLBRILF-SUYBHAEQSA-N |
| XLogP | 1.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |