C39H25N5O — CID 168933434
N-methylidene-16-oxo-11,15-diphenyl-11,15,20-triazaheptacyclo[15.11.0.02,14.04,12.05,10.019,27.021,26]octacosa-1(17),2(14),3,5,7,9,12,18,21,23,25,27-dodecaene-20-carboximidamide (PubChem CID 168933434) has the molecular formula C39H25N5O and a molecular weight of 579.66 g/mol. Its IUPAC name is N-methylidene-16-oxo-11,15-diphenyl-11,15,20-triazaheptacyclo[15.11.0.02,14.04,12.05,10.019,27.021,26]octacosa-1(17),2(14),3,5,7,9,12,18,21,23,25,27-dodecaene-20-carboximidamide.
| Compound Name | N-methylidene-16-oxo-11,15-diphenyl-11,15,20-triazaheptacyclo[15.11.0.02,14.04,12.05,10.019,27.021,26]octacosa-1(17),2(14),3,5,7,9,12,18,21,23,25,27-dodecaene-20-carboximidamide |
|---|---|
| PubChem CID | 168933434 |
| Molecular Formula | C39H25N5O |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | N-methylidene-16-oxo-11,15-diphenyl-11,15,20-triazaheptacyclo[15.11.0.02,14.04,12.05,10.019,27.021,26]octacosa-1(17),2(14),3,5,7,9,12,18,21,23,25,27-dodecaene-20-carboximidamide |
| SMILES | [H]/N=C(\N=C)n1c2ccccc2c2cc3c(cc21)c(=O)n(-c1ccccc1)c1cc2c(cc31)c1ccccc1n2-c1ccccc1 |
| InChI | InChI=1S/C39H25N5O/c1-41-39(40)44-34-19-11-9-17-27(34)29-20-28-31-21-30-26-16-8-10-18-33(26)42(24-12-4-2-5-13-24)36(30)23-37(31)43(25-14-6-3-7-15-25)38(45)32(28)22-35(29)44/h2-23,40H,1H2/b40-39+ |
| InChIKey | HJLJPFDQNBZRLE-XQQUEIPISA-N |
| XLogP | 8.83 |
| TPSA | 68.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|