C25H37N5 — CID 168936902
(2E,4E,6E)-5,7-dimethyl-N-[[4-[(Z)-2-(methylideneamino)ethenyl]iminocyclohexa-1,5-dien-1-yl]methyl]-4-piperazin-1-ylnona-2,4,6-trien-3-amine (PubChem CID 168936902) has the molecular formula C25H37N5 and a molecular weight of 407.61 g/mol. Its IUPAC name is (2E,4E,6E)-5,7-dimethyl-N-[[4-[(Z)-2-(methylideneamino)ethenyl]iminocyclohexa-1,5-dien-1-yl]methyl]-4-piperazin-1-ylnona-2,4,6-trien-3-amine.
| Compound Name | (2E,4E,6E)-5,7-dimethyl-N-[[4-[(Z)-2-(methylideneamino)ethenyl]iminocyclohexa-1,5-dien-1-yl]methyl]-4-piperazin-1-ylnona-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 168936902 |
| Molecular Formula | C25H37N5 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | (2E,4E,6E)-5,7-dimethyl-N-[[4-[(Z)-2-(methylideneamino)ethenyl]iminocyclohexa-1,5-dien-1-yl]methyl]-4-piperazin-1-ylnona-2,4,6-trien-3-amine |
| SMILES | C=N/C=C\N=C1\C=CC(CNC(=C/C)/C(=C(C)\C=C(/C)CC)N2CCNCC2)=CC1 |
| InChI | InChI=1S/C25H37N5/c1-6-20(3)18-21(4)25(30-16-14-27-15-17-30)24(7-2)29-19-22-8-10-23(11-9-22)28-13-12-26-5/h7-10,12-13,18,27,29H,5-6,11,14-17,19H2,1-4H3/b13-12-,20-18+,24-7+,25-21+,28-23- |
| InChIKey | BWBLTKOSZCUTSK-JFILGJAGSA-N |
| XLogP | 4.51 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|