About ethane;1-ethyl-2-(3-methylhexan-2-yl)cyclopentane;2-methylbutane
ethane;1-ethyl-2-(3-methylhexan-2-yl)cyclopentane;2-methylbutane (PubChem CID 168937920) has the molecular formula C21H46
and a molecular weight of 298.60 g/mol. Its IUPAC name is ethane;1-ethyl-2-(3-methylhexan-2-yl)cyclopentane;2-methylbutane.
Molecular Properties
| Compound Name | ethane;1-ethyl-2-(3-methylhexan-2-yl)cyclopentane;2-methylbutane |
| PubChem CID | 168937920 |
| Molecular Formula | C21H46 |
| Molecular Weight | 298.60 g/mol |
| Exact Mass | 298.36 |
| IUPAC Name | ethane;1-ethyl-2-(3-methylhexan-2-yl)cyclopentane;2-methylbutane |
| SMILES | CC.CCC(C)C.CCCC(C)C(C)C1CCCC1CC |
| InChI | InChI=1S/C14H28.C5H12.C2H6/c1-5-8-11(3)12(4)14-10-7-9-13(14)6-2;1-4-5(2)3;1-2/h11-14H,5-10H2,1-4H3;5H,4H2,1-3H3;1-2H3 |
| InChIKey | KVYNAYYFLUAKNP-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.60 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1-ethyl-2-(3-methylhexan-2-yl)cyclopentane;2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-2-(3-methylhexan-2-yl)cyclopentane;2-methylbutane?
The IUPAC name of ethane;1-ethyl-2-(3-methylhexan-2-yl)cyclopentane;2-methylbutane (CID 168937920) is ethane;1-ethyl-2-(3-methylhexan-2-yl)cyclopentane;2-methylbutane.
What is the SMILES notation for ethane;1-ethyl-2-(3-methylhexan-2-yl)cyclopentane;2-methylbutane?
The canonical SMILES for ethane;1-ethyl-2-(3-methylhexan-2-yl)cyclopentane;2-methylbutane is CC.CCC(C)C.CCCC(C)C(C)C1CCCC1CC.
What is the InChIKey of ethane;1-ethyl-2-(3-methylhexan-2-yl)cyclopentane;2-methylbutane?
The InChIKey is KVYNAYYFLUAKNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28.C5H12.C2H6/c1-5-8-11(3)12(4)14-10-7-9-13(14)6-2;1-4-5(2)3;1-2/h11-14H,5-10H2,1-4H3;5H,4H2,1-3H3;1-2H3.
What are the key properties of ethane;1-ethyl-2-(3-methylhexan-2-yl)cyclopentane;2-methylbutane?
ethane;1-ethyl-2-(3-methylhexan-2-yl)cyclopentane;2-methylbutane has a molecular weight of 298.60 g/mol, XLogP of 7.96, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-2-(3-methylhexan-2-yl)cyclopentane;2-methylbutane is sourced from PubChem (CID 168937920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).