C30H31N3O6 — CID 168938744
tert-butyl 2-[3-[3-(1,3-dioxoisoindol-2-yl)prop-1-ynyl]-4-methoxycarbonylphenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 168938744) has the molecular formula C30H31N3O6 and a molecular weight of 529.59 g/mol. Its IUPAC name is tert-butyl 2-[3-[3-(1,3-dioxoisoindol-2-yl)prop-1-ynyl]-4-methoxycarbonylphenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 2-[3-[3-(1,3-dioxoisoindol-2-yl)prop-1-ynyl]-4-methoxycarbonylphenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 168938744 |
| Molecular Formula | C30H31N3O6 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | tert-butyl 2-[3-[3-(1,3-dioxoisoindol-2-yl)prop-1-ynyl]-4-methoxycarbonylphenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | COC(=O)c1ccc(N2CC3CN(C(=O)OC(C)(C)C)CC3C2)cc1C#CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H31N3O6/c1-30(2,3)39-29(37)32-17-20-15-31(16-21(20)18-32)22-11-12-23(28(36)38-4)19(14-22)8-7-13-33-26(34)24-9-5-6-10-25(24)27(33)35/h5-6,9-12,14,20-21H,13,15-18H2,1-4H3 |
| InChIKey | SOYKLQQHZQYMLY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|