C25H21N3O5 — CID 168938787
methyl 4-(2,6-diazaspiro[3.3]heptane-2-carbonyl)-2-[3-(1,3-dioxoisoindol-2-yl)prop-1-ynyl]benzoate (PubChem CID 168938787) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is methyl 4-(2,6-diazaspiro[3.3]heptane-2-carbonyl)-2-[3-(1,3-dioxoisoindol-2-yl)prop-1-ynyl]benzoate.
| Compound Name | methyl 4-(2,6-diazaspiro[3.3]heptane-2-carbonyl)-2-[3-(1,3-dioxoisoindol-2-yl)prop-1-ynyl]benzoate |
|---|---|
| PubChem CID | 168938787 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | methyl 4-(2,6-diazaspiro[3.3]heptane-2-carbonyl)-2-[3-(1,3-dioxoisoindol-2-yl)prop-1-ynyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N2CC3(CNC3)C2)cc1C#CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H21N3O5/c1-33-24(32)18-9-8-17(21(29)27-14-25(15-27)12-26-13-25)11-16(18)5-4-10-28-22(30)19-6-2-3-7-20(19)23(28)31/h2-3,6-9,11,26H,10,12-15H2,1H3 |
| InChIKey | PZAQPOZZDATRDZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|