C16H12BrNO5 — CID 118394863
methyl 2-(bromomethyl)-5-[(1,3-dioxoisoindol-2-yl)methyl]furan-3-carboxylate (PubChem CID 118394863) has the molecular formula C16H12BrNO5 and a molecular weight of 378.18 g/mol. Its IUPAC name is methyl 2-(bromomethyl)-5-[(1,3-dioxoisoindol-2-yl)methyl]furan-3-carboxylate.
| Compound Name | methyl 2-(bromomethyl)-5-[(1,3-dioxoisoindol-2-yl)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 118394863 |
| Molecular Formula | C16H12BrNO5 |
| Molecular Weight | 378.18 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | methyl 2-(bromomethyl)-5-[(1,3-dioxoisoindol-2-yl)methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(CN2C(=O)c3ccccc3C2=O)oc1CBr |
| InChI | InChI=1S/C16H12BrNO5/c1-22-16(21)12-6-9(23-13(12)7-17)8-18-14(19)10-4-2-3-5-11(10)15(18)20/h2-6H,7-8H2,1H3 |
| InChIKey | FUROLEQIZOAOBW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.18 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|