C25H21NO8 — CID 31120826
methyl 2-[[5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxybenzoyl]oxymethyl]furan-3-carboxylate (PubChem CID 31120826) has the molecular formula C25H21NO8 and a molecular weight of 463.44 g/mol. Its IUPAC name is methyl 2-[[5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxybenzoyl]oxymethyl]furan-3-carboxylate.
| Compound Name | methyl 2-[[5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxybenzoyl]oxymethyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 31120826 |
| Molecular Formula | C25H21NO8 |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | methyl 2-[[5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxybenzoyl]oxymethyl]furan-3-carboxylate |
| SMILES | CCOc1ccc(CN2C(=O)c3ccccc3C2=O)cc1C(=O)OCc1occc1C(=O)OC |
| InChI | InChI=1S/C25H21NO8/c1-3-32-20-9-8-15(13-26-22(27)16-6-4-5-7-17(16)23(26)28)12-19(20)25(30)34-14-21-18(10-11-33-21)24(29)31-2/h4-12H,3,13-14H2,1-2H3 |
| InChIKey | FVHPBFZDIGGTDC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 112.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|