C27H24N2O6 — CID 42974938
(1-anilino-1-oxopropan-2-yl) 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxybenzoate (PubChem CID 42974938) has the molecular formula C27H24N2O6 and a molecular weight of 472.50 g/mol. Its IUPAC name is (1-anilino-1-oxopropan-2-yl) 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxybenzoate.
| Compound Name | (1-anilino-1-oxopropan-2-yl) 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxybenzoate |
|---|---|
| PubChem CID | 42974938 |
| Molecular Formula | C27H24N2O6 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | (1-anilino-1-oxopropan-2-yl) 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxybenzoate |
| SMILES | CCOc1ccc(CN2C(=O)c3ccccc3C2=O)cc1C(=O)OC(C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C27H24N2O6/c1-3-34-23-14-13-18(16-29-25(31)20-11-7-8-12-21(20)26(29)32)15-22(23)27(33)35-17(2)24(30)28-19-9-5-4-6-10-19/h4-15,17H,3,16H2,1-2H3,(H,28,30) |
| InChIKey | DNYHKZHUPVXVRL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|