C24H23N3O7 — CID 55458253
[1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate (PubChem CID 55458253) has the molecular formula C24H23N3O7 and a molecular weight of 465.46 g/mol. Its IUPAC name is [1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate.
| Compound Name | [1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 55458253 |
| Molecular Formula | C24H23N3O7 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | [1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzoate |
| SMILES | COc1ccc(CN2C(=O)c3ccccc3C2=O)cc1C(=O)OC(C)C(=O)NC(=O)NC1CC1 |
| InChI | InChI=1S/C24H23N3O7/c1-13(20(28)26-24(32)25-15-8-9-15)34-23(31)18-11-14(7-10-19(18)33-2)12-27-21(29)16-5-3-4-6-17(16)22(27)30/h3-7,10-11,13,15H,8-9,12H2,1-2H3,(H2,25,26,28,32) |
| InChIKey | BIJQYTIWLBRQQM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|