C24H21N3O4 — CID 168938653
methyl 4-(2,6-diazaspiro[3.3]heptan-2-yl)-2-[3-(1,3-dioxoisoindol-2-yl)prop-1-ynyl]benzoate (PubChem CID 168938653) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is methyl 4-(2,6-diazaspiro[3.3]heptan-2-yl)-2-[3-(1,3-dioxoisoindol-2-yl)prop-1-ynyl]benzoate.
| Compound Name | methyl 4-(2,6-diazaspiro[3.3]heptan-2-yl)-2-[3-(1,3-dioxoisoindol-2-yl)prop-1-ynyl]benzoate |
|---|---|
| PubChem CID | 168938653 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | methyl 4-(2,6-diazaspiro[3.3]heptan-2-yl)-2-[3-(1,3-dioxoisoindol-2-yl)prop-1-ynyl]benzoate |
| SMILES | COC(=O)c1ccc(N2CC3(CNC3)C2)cc1C#CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H21N3O4/c1-31-23(30)18-9-8-17(26-14-24(15-26)12-25-13-24)11-16(18)5-4-10-27-21(28)19-6-2-3-7-20(19)22(27)29/h2-3,6-9,11,25H,10,12-15H2,1H3 |
| InChIKey | AGNXBFHXETVVDN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|