C13H24N2O3 — CID 168939133
(E,2S)-2-acetamido-6-ethoxy-N-ethyl-N-methylhex-4-enamide (PubChem CID 168939133) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is (E,2S)-2-acetamido-6-ethoxy-N-ethyl-N-methylhex-4-enamide.
| Compound Name | (E,2S)-2-acetamido-6-ethoxy-N-ethyl-N-methylhex-4-enamide |
|---|---|
| PubChem CID | 168939133 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | (E,2S)-2-acetamido-6-ethoxy-N-ethyl-N-methylhex-4-enamide |
| SMILES | CCOC/C=C/C[C@H](NC(C)=O)C(=O)N(C)CC |
| InChI | InChI=1S/C13H24N2O3/c1-5-15(4)13(17)12(14-11(3)16)9-7-8-10-18-6-2/h7-8,12H,5-6,9-10H2,1-4H3,(H,14,16)/b8-7+/t12-/m0/s1 |
| InChIKey | YGGXLRSNODXKRC-GUOLPTJISA-N |
| XLogP | 0.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|