C22H30N4O5S2 — CID 168940163
N-[2-(2-ethenylsulfonylhydrazinyl)-2-oxoethyl]-N-[1-(1-naphthalen-1-ylethyl)piperidin-4-yl]methanesulfonamide (PubChem CID 168940163) has the molecular formula C22H30N4O5S2 and a molecular weight of 494.64 g/mol. Its IUPAC name is N-[2-(2-ethenylsulfonylhydrazinyl)-2-oxoethyl]-N-[1-(1-naphthalen-1-ylethyl)piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[2-(2-ethenylsulfonylhydrazinyl)-2-oxoethyl]-N-[1-(1-naphthalen-1-ylethyl)piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168940163 |
| Molecular Formula | C22H30N4O5S2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | N-[2-(2-ethenylsulfonylhydrazinyl)-2-oxoethyl]-N-[1-(1-naphthalen-1-ylethyl)piperidin-4-yl]methanesulfonamide |
| SMILES | C=CS(=O)(=O)NNC(=O)CN(C1CCN(C(C)c2cccc3ccccc23)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C22H30N4O5S2/c1-4-33(30,31)24-23-22(27)16-26(32(3,28)29)19-12-14-25(15-13-19)17(2)20-11-7-9-18-8-5-6-10-21(18)20/h4-11,17,19,24H,1,12-16H2,2-3H3,(H,23,27) |
| InChIKey | IRBQSKXVRMMIRM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|