C21H38N2O2 — CID 168940416
2-benzylmorpholine-4-carbaldehyde;1,2-dimethylazetidine;ethane (PubChem CID 168940416) has the molecular formula C21H38N2O2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 2-benzylmorpholine-4-carbaldehyde;1,2-dimethylazetidine;ethane.
| Compound Name | 2-benzylmorpholine-4-carbaldehyde;1,2-dimethylazetidine;ethane |
|---|---|
| PubChem CID | 168940416 |
| Molecular Formula | C21H38N2O2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | 2-benzylmorpholine-4-carbaldehyde;1,2-dimethylazetidine;ethane |
| SMILES | CC.CC.CC1CCN1C.O=CN1CCOC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C12H15NO2.C5H11N.2C2H6/c14-10-13-6-7-15-12(9-13)8-11-4-2-1-3-5-11;1-5-3-4-6(5)2;2*1-2/h1-5,10,12H,6-9H2;5H,3-4H2,1-2H3;2*1-2H3 |
| InChIKey | SXBQQDIWSLQFFK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|