C13H16BrFN2O4S — CID 168940429
3-bromo-4-fluoro-N-methyl-N-(2-morpholin-4-yl-2-oxoethyl)benzenesulfonamide (PubChem CID 168940429) has the molecular formula C13H16BrFN2O4S and a molecular weight of 395.25 g/mol. Its IUPAC name is 3-bromo-4-fluoro-N-methyl-N-(2-morpholin-4-yl-2-oxoethyl)benzenesulfonamide.
| Compound Name | 3-bromo-4-fluoro-N-methyl-N-(2-morpholin-4-yl-2-oxoethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 168940429 |
| Molecular Formula | C13H16BrFN2O4S |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 3-bromo-4-fluoro-N-methyl-N-(2-morpholin-4-yl-2-oxoethyl)benzenesulfonamide |
| SMILES | CN(CC(=O)N1CCOCC1)S(=O)(=O)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C13H16BrFN2O4S/c1-16(9-13(18)17-4-6-21-7-5-17)22(19,20)10-2-3-12(15)11(14)8-10/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | OBEVZFQQYOLBOM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |