C13H13ClN2 — CID 168941463
5-chloro-3-(1,2,3,6-tetrahydropyridin-5-yl)-1H-indole (PubChem CID 168941463) has the molecular formula C13H13ClN2 and a molecular weight of 232.71 g/mol. Its IUPAC name is 5-chloro-3-(1,2,3,6-tetrahydropyridin-5-yl)-1H-indole.
| Compound Name | 5-chloro-3-(1,2,3,6-tetrahydropyridin-5-yl)-1H-indole |
|---|---|
| PubChem CID | 168941463 |
| Molecular Formula | C13H13ClN2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 5-chloro-3-(1,2,3,6-tetrahydropyridin-5-yl)-1H-indole |
| SMILES | Clc1ccc2[nH]cc(C3=CCCNC3)c2c1 |
| InChI | InChI=1S/C13H13ClN2/c14-10-3-4-13-11(6-10)12(8-16-13)9-2-1-5-15-7-9/h2-4,6,8,15-16H,1,5,7H2 |
| InChIKey | NNGUQRONEZILFK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |