C12H9ClN2O2 — CID 90829094
3-(5-chloro-1H-indol-3-yl)-1H-pyrrole-2,5-diol (PubChem CID 90829094) has the molecular formula C12H9ClN2O2 and a molecular weight of 248.67 g/mol. Its IUPAC name is 3-(5-chloro-1H-indol-3-yl)-1H-pyrrole-2,5-diol.
| Compound Name | 3-(5-chloro-1H-indol-3-yl)-1H-pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90829094 |
| Molecular Formula | C12H9ClN2O2 |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 3-(5-chloro-1H-indol-3-yl)-1H-pyrrole-2,5-diol |
| SMILES | Oc1cc(-c2c[nH]c3ccc(Cl)cc23)c(O)[nH]1 |
| InChI | InChI=1S/C12H9ClN2O2/c13-6-1-2-10-7(3-6)9(5-14-10)8-4-11(16)15-12(8)17/h1-5,14-17H |
| InChIKey | JPWUMVDWRIIQMD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |