C16H24F3N3O2 — CID 168945345
tert-butyl 4-(4-ethylpyrazol-1-yl)-2-(trifluoromethyl)piperidine-1-carboxylate (PubChem CID 168945345) has the molecular formula C16H24F3N3O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is tert-butyl 4-(4-ethylpyrazol-1-yl)-2-(trifluoromethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-ethylpyrazol-1-yl)-2-(trifluoromethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168945345 |
| Molecular Formula | C16H24F3N3O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | tert-butyl 4-(4-ethylpyrazol-1-yl)-2-(trifluoromethyl)piperidine-1-carboxylate |
| SMILES | CCc1cnn(C2CCN(C(=O)OC(C)(C)C)C(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C16H24F3N3O2/c1-5-11-9-20-22(10-11)12-6-7-21(13(8-12)16(17,18)19)14(23)24-15(2,3)4/h9-10,12-13H,5-8H2,1-4H3 |
| InChIKey | QQTKAVSEYXLYAB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |