C56H60F3N9O9S2Si — CID 168946234
CID 168946234 (PubChem CID 168946234) has the molecular formula C56H60F3N9O9S2Si and a molecular weight of 1152.36 g/mol.
| Compound Name | CID 168946234 |
|---|---|
| PubChem CID | 168946234 |
| Molecular Formula | C56H60F3N9O9S2Si |
| Molecular Weight | 1152.36 g/mol |
| Exact Mass | 1151.37 |
| IUPAC Name | — |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H]([Si]NC(=O)CCCCOC(=O)c2ccc(-c3cnc(N)c4c(-c5ccc(NS(=O)(=O)C(F)F)c(O[C@@H](C)c6ccc(F)cc6)c5)nn(C)c34)cc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C56H60F3N9O9S2Si/c1-31-49(78-30-63-31)36-12-10-33(11-13-36)27-62-52(71)43-26-40(69)29-68(43)53(72)50(56(3,4)5)80-66-45(70)9-7-8-24-76-54(73)37-16-14-35(15-17-37)41-28-61-51(60)46-47(64-67(6)48(41)46)38-20-23-42(65-79(74,75)55(58)59)44(25-38)77-32(2)34-18-21-39(57)22-19-34/h10-23,25,28,30,32,40,43,50,55,65,69H,7-9,24,26-27,29H2,1-6H3,(H2,60,61)(H,62,71)(H,66,70)/t32-,40+,43-,50+/m0/s1 |
| InChIKey | WARKASQZKKFUDE-MXODDYBLSA-N |
| XLogP | 8.74 |
| TPSA | 250.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1152.36 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|