C13H11F2NO — CID 168947989
3-[(2,5-difluorophenyl)methyl]-2-methoxypyridine (PubChem CID 168947989) has the molecular formula C13H11F2NO and a molecular weight of 235.23 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)methyl]-2-methoxypyridine.
| Compound Name | 3-[(2,5-difluorophenyl)methyl]-2-methoxypyridine |
|---|---|
| PubChem CID | 168947989 |
| Molecular Formula | C13H11F2NO |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 3-[(2,5-difluorophenyl)methyl]-2-methoxypyridine |
| SMILES | COc1ncccc1Cc1cc(F)ccc1F |
| InChI | InChI=1S/C13H11F2NO/c1-17-13-9(3-2-6-16-13)7-10-8-11(14)4-5-12(10)15/h2-6,8H,7H2,1H3 |
| InChIKey | VNWHLSUBCRONJH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |